Products 874590-32-6
CAS 874590-32-6 appears in our catalog under these names: M1001/ 100%, M1001, M1001, 98+%, 98+%, M1001, 99.51%, 3-{[2-(pyrrolidin-1-yl)phenyl]imino}-2,3-dihydro-1λâ¶,2-benzothiazole-1,1-dione, ≥99%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
1,1-dioxo-N-(2-pyrrolidin-1-ylphenyl)-1,2-benzothiazol-3-amine (CAS 874590-32-6) is a chemical compound with the molecular formula C17H17N3O2S and a molecular weight of 327.4 g/mol. IUPAC name: 1,1-dioxo-N-(2-pyrrolidin-1-ylphenyl)-1,2-benzothiazol-3-amine. InChIKey: LONXCUOJVJLTIP-UHFFFAOYSA-N.
| Molecular formula | C17H17N3O2S |
|---|---|
| Molecular weight | 327.4 g/mol |
| IUPAC name | 1,1-dioxo-N-(2-pyrrolidin-1-ylphenyl)-1,2-benzothiazol-3-amine |
| InChIKey | LONXCUOJVJLTIP-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)C2=CC=CC=C2NC3=NS(=O)(=O)C4=CC=CC=C43 |
Computed by PubChem (NCBI)