Products 2284460-01-9
CAS 2284460-01-9 appears in our catalog under these names: MC2590/ 99.14% (existing batch purity), MC2590, MC2590, 98.71%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg, 10mg, 50 mg, 5 mg.
(E)-N-hydroxy-3-[5-[(2-naphthalen-1-ylacetyl)amino]-2-pyridinyl]prop-2-enamide (CAS 2284460-01-9) is a chemical compound with the molecular formula C20H17N3O3 and a molecular weight of 347.4 g/mol. IUPAC name: (E)-N-hydroxy-3-[5-[(2-naphthalen-1-ylacetyl)amino]-2-pyridinyl]prop-2-enamide. InChIKey: DTNVLAIWDVXDJR-ZHACJKMWSA-N.
| Molecular formula | C20H17N3O3 |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | (E)-N-hydroxy-3-[5-[(2-naphthalen-1-ylacetyl)amino]-2-pyridinyl]prop-2-enamide |
| InChIKey | DTNVLAIWDVXDJR-ZHACJKMWSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC=C2CC(=O)NC3=CN=C(C=C3)/C=C/C(=O)NO |
Computed by PubChem (NCBI)