CAS 111797-22-9 appears in our catalog under these names: MD2-IN-1/ 99.43% (existing batch purity), MD2–IN–1, MD2-IN-1, MD2-IN-1, ≥99%, ≥99%, MD2-IN-1, 99.88%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 2mg.
(E)-1-(3,4-dimethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one (CAS 111797-22-9) is a chemical compound with the molecular formula C20H22O6 and a molecular weight of 358.4 g/mol. IUPAC name: (E)-1-(3,4-dimethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one. InChIKey: ZKYRYELHPFTZTI-SOFGYWHQSA-N.
| Molecular formula | C20H22O6 |
|---|---|
| Molecular weight | 358.4 g/mol |
| IUPAC name | (E)-1-(3,4-dimethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)prop-2-en-1-one |
| InChIKey | ZKYRYELHPFTZTI-SOFGYWHQSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)/C=C/C2=CC(=C(C(=C2)OC)OC)OC)OC |
Computed by PubChem (NCBI)