Products 2143463-35-6
CAS 2143463-35-6 appears in our catalog under these names: MDH1-IN-2/ 98.39% (existing batch purity), MDH1–IN–2, MDH1-IN-2 99%, MDH1-IN-2, MDH1-IN-2, 98.70%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 10mg, 25mg, 5mg, 50mg, 100mg, 250mg, 1g.
Methyl 4-methoxy-3-[[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]amino]benzoate (CAS 2143463-35-6) is a chemical compound with the molecular formula C25H33NO5 and a molecular weight of 427.5 g/mol. IUPAC name: methyl 4-methoxy-3-[[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]amino]benzoate. InChIKey: MHYUTDIUXARMRO-UHFFFAOYSA-N.
| Molecular formula | C25H33NO5 |
|---|---|
| Molecular weight | 427.5 g/mol |
| IUPAC name | methyl 4-methoxy-3-[[2-[4-(2,4,4-trimethylpentan-2-yl)phenoxy]acetyl]amino]benzoate |
| InChIKey | MHYUTDIUXARMRO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CC(C)(C)C1=CC=C(C=C1)OCC(=O)NC2=C(C=CC(=C2)C(=O)OC)OC |
Computed by PubChem (NCBI)