CAS 1445251-22-8 appears in our catalog under these names: ME0328, ME0328/ 99.84% (existing batch purity), ME0328 99%, (S)-3-(4-Oxo-3,4-dihydroquinazolin-2-yl)-N-(1-phenylethyl)propanamide, 99%, 99%, ME0328, 99.64%. Offered by: GLPBio, TargetMol, Ambeed, Chemat, MedChemExpress. Available pack sizes: 10mg, 10mM (in 1ml dmso), 50mg, 5mg, 25mg, 100mg, 1mg, 250mg.
3-(4-oxo-3H-quinazolin-2-yl)-N-[(1S)-1-phenylethyl]propanamide (CAS 1445251-22-8) is a chemical compound with the molecular formula C19H19N3O2 and a molecular weight of 321.4 g/mol. IUPAC name: 3-(4-oxo-3H-quinazolin-2-yl)-N-[(1S)-1-phenylethyl]propanamide. InChIKey: QIHBWVVVRYYYRO-ZDUSSCGKSA-N.
| Molecular formula | C19H19N3O2 |
|---|---|
| Molecular weight | 321.4 g/mol |
| IUPAC name | 3-(4-oxo-3H-quinazolin-2-yl)-N-[(1S)-1-phenylethyl]propanamide |
| InChIKey | QIHBWVVVRYYYRO-ZDUSSCGKSA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)NC(=O)CCC2=NC3=CC=CC=C3C(=O)N2 |
Computed by PubChem (NCBI)