cas: 1523541-90-3 — see every product listed under this CAS number, including other names
METHYL (2S,4S)-1-BOC-4-TRIFLUOROMETHYLPYRROLIDINE-2-CARBOXYLATE, 97%, 97% (CAS 1523541-90-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HXZF-100mg |
| cas | 1523541-90-3 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 323.60 Pln | |
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 500mg | 654.80 Pln | |
| Chemat | 1g | 952.40 Pln | |
| Chemat | 5g | 2738.00 Pln | |
| Chemat | 10g | 4869.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 2-O-methyl (2S,4S)-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate (CAS 1523541-90-3) is a chemical compound with the molecular formula C12H18F3NO4 and a molecular weight of 297.27 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S,4S)-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate. InChIKey: BIBYRUVESDZUDY-YUMQZZPRSA-N.
| Molecular formula | C12H18F3NO4 |
|---|---|
| Molecular weight | 297.27 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S,4S)-4-(trifluoromethyl)pyrrolidine-1,2-dicarboxylate |
| InChIKey | BIBYRUVESDZUDY-YUMQZZPRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)OC)C(F)(F)F |
Computed by PubChem (NCBI)