CAS 2756314-06-2 appears in our catalog under these names: Ethyl 2-(2-azaspiro(3.3)heptan-6-yl)acetate 2,2,2-trifluoroacetate, 98%, Ethyl 2-(2-azaspiro[3.3]heptan-6-yl)acetate 2,2,2-trifluoroacetate, 97%, Ethyl 2-(2-azaspiro[3.3]heptan-6-yl)acetate 2,2,2-trifluoroacetate, 97%, 97%. Offered by: AmBeed, Fluorochem, Chemat. Available pack sizes: 1g, 100mg, 250mg.
Ethyl 2-(2-azaspiro[3.3]heptan-6-yl)acetate;2,2,2-trifluoroacetic acid (CAS 2756314-06-2) is a chemical compound with the molecular formula C12H18F3NO4 and a molecular weight of 297.27 g/mol. IUPAC name: ethyl 2-(2-azaspiro[3.3]heptan-6-yl)acetate;2,2,2-trifluoroacetic acid. InChIKey: UHKUDTYCVAQWGK-UHFFFAOYSA-N.
| Molecular formula | C12H18F3NO4 |
|---|---|
| Molecular weight | 297.27 g/mol |
| IUPAC name | ethyl 2-(2-azaspiro[3.3]heptan-6-yl)acetate;2,2,2-trifluoroacetic acid |
| InChIKey | UHKUDTYCVAQWGK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1CC2(C1)CNC2.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)