cas: 1363165-85-8 — see every product listed under this CAS number, including other names
METHYL 1-BOC-3-ETHYLPIPERIDINE-3-CARBOXYLATE, 98% (CAS 1363165-85-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387283-1G |
| cas | 1363165-85-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1237.08 Pln | |
| Fluorochem | 5g | 3017.71 Pln | |
| Fluorochem | 250mg | 476.93 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-O-tert-butyl 3-O-methyl 3-ethylpiperidine-1,3-dicarboxylate (CAS 1363165-85-8) is a chemical compound with the molecular formula C14H25NO4 and a molecular weight of 271.35 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 3-ethylpiperidine-1,3-dicarboxylate. InChIKey: HZCODVOTFNOVHS-UHFFFAOYSA-N.
| Molecular formula | C14H25NO4 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 3-ethylpiperidine-1,3-dicarboxylate |
| InChIKey | HZCODVOTFNOVHS-UHFFFAOYSA-N |
| SMILES | CCC1(CCCN(C1)C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)