cas: 1363165-85-8 — see every product listed under this CAS number, including other names
Methyl 1-Boc-3-ethylpiperidine-3-carboxylate, 98%, 98% (CAS 1363165-85-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1122LV-100mg |
| cas | 1363165-85-8 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 208.40 Pln | |
| Chemat | 1g | 765.20 Pln | |
| Chemat | 5g | 1840.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 3-O-methyl 3-ethylpiperidine-1,3-dicarboxylate (CAS 1363165-85-8) is a chemical compound with the molecular formula C14H25NO4 and a molecular weight of 271.35 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 3-ethylpiperidine-1,3-dicarboxylate. InChIKey: HZCODVOTFNOVHS-UHFFFAOYSA-N.
| Molecular formula | C14H25NO4 |
|---|---|
| Molecular weight | 271.35 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 3-ethylpiperidine-1,3-dicarboxylate |
| InChIKey | HZCODVOTFNOVHS-UHFFFAOYSA-N |
| SMILES | CCC1(CCCN(C1)C(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)