cas: 1243144-97-9 — see every product listed under this CAS number, including other names
METHYL 2-(2-BROMOPHENYL)-3-OXOBUTANOATE, 97% (CAS 1243144-97-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F468451-100MG |
| cas | 1243144-97-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 476.93 Pln | |
| Fluorochem | 250mg | 763.29 Pln | |
| Fluorochem | 1g | 1830.62 Pln | |
| Fluorochem | 5g | 6506.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-(2-bromophenyl)-3-oxobutanoate (CAS 1243144-97-9) is a chemical compound with the molecular formula C11H11BrO3 and a molecular weight of 271.11 g/mol. IUPAC name: methyl 2-(2-bromophenyl)-3-oxobutanoate. InChIKey: KWNLLHXMARGDDM-UHFFFAOYSA-N.
| Molecular formula | C11H11BrO3 |
|---|---|
| Molecular weight | 271.11 g/mol |
| IUPAC name | methyl 2-(2-bromophenyl)-3-oxobutanoate |
| InChIKey | KWNLLHXMARGDDM-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C1=CC=CC=C1Br)C(=O)OC |
Computed by PubChem (NCBI)