cas: 1267856-55-2 — see every product listed under this CAS number, including other names
METHYL 2-(5-BROMO-3-FLUORO-2-PYRIDYL)ACETATE, 98% (CAS 1267856-55-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F834548-100MG |
| cas | 1267856-55-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 591.48 Pln | |
| Fluorochem | 250mg | 846.59 Pln | |
| Fluorochem | 1g | 2262.76 Pln | |
| Fluorochem | 5g | 6287.39 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-(5-bromo-3-fluoro-2-pyridinyl)acetate (CAS 1267856-55-2) is a chemical compound with the molecular formula C8H7BrFNO2 and a molecular weight of 248.05 g/mol. IUPAC name: methyl 2-(5-bromo-3-fluoro-2-pyridinyl)acetate. InChIKey: NNNSZOJUJGVRTL-UHFFFAOYSA-N.
| Molecular formula | C8H7BrFNO2 |
|---|---|
| Molecular weight | 248.05 g/mol |
| IUPAC name | methyl 2-(5-bromo-3-fluoro-2-pyridinyl)acetate |
| InChIKey | NNNSZOJUJGVRTL-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C=C(C=N1)Br)F |
Computed by PubChem (NCBI)