Products 1260679-48-8
CAS 1260679-48-8 appears in our catalog under these names: (4-Amino-2-bromo-5-fluorophenyl)acetic acid, 96%, 2-(4-Amino-2-bromo-5-fluorophenyl)acetic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 25g.
2-(4-amino-2-bromo-5-fluorophenyl)acetic acid (CAS 1260679-48-8) is a chemical compound with the molecular formula C8H7BrFNO2 and a molecular weight of 248.05 g/mol. IUPAC name: 2-(4-amino-2-bromo-5-fluorophenyl)acetic acid. InChIKey: PSDBGKLKUHSFQY-UHFFFAOYSA-N.
| Molecular formula | C8H7BrFNO2 |
|---|---|
| Molecular weight | 248.05 g/mol |
| IUPAC name | 2-(4-amino-2-bromo-5-fluorophenyl)acetic acid |
| InChIKey | PSDBGKLKUHSFQY-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)N)Br)CC(=O)O |
Computed by PubChem (NCBI)