CAS 1694614-97-5 appears in our catalog under these names: 2-Amino-6-bromo-5-fluoro-3-methylbenzoic acid, 95%, 2-Amino-6-bromo-5-fluoro-3-methylbenzoic Acid, ≥95%, ≥95%, 2-Amino-6-bromo-5-fluoro-3-methylbenzoic acid, ≥95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g.
2-amino-6-bromo-5-fluoro-3-methylbenzoic acid (CAS 1694614-97-5) is a chemical compound with the molecular formula C8H7BrFNO2 and a molecular weight of 248.05 g/mol. IUPAC name: 2-amino-6-bromo-5-fluoro-3-methylbenzoic acid. InChIKey: KANXKEQBAPAEAX-UHFFFAOYSA-N.
| Molecular formula | C8H7BrFNO2 |
|---|---|
| Molecular weight | 248.05 g/mol |
| IUPAC name | 2-amino-6-bromo-5-fluoro-3-methylbenzoic acid |
| InChIKey | KANXKEQBAPAEAX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1N)C(=O)O)Br)F |
Computed by PubChem (NCBI)