cas: 127861-30-7 — see every product listed under this CAS number, including other names
METHYL 2-CHLORO-6-METHOXYPYRIMIDINE-4-CARBOXYLATE, 97% (CAS 127861-30-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F469023-100MG |
| cas | 127861-30-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 372.80 Pln | |
| Fluorochem | 250mg | 445.69 Pln | |
| Fluorochem | 1g | 1091.30 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-chloro-6-methoxypyrimidine-4-carboxylate (CAS 127861-30-7) is a chemical compound with the molecular formula C7H7ClN2O3 and a molecular weight of 202.59 g/mol. IUPAC name: methyl 2-chloro-6-methoxypyrimidine-4-carboxylate. InChIKey: OBFFZLIOVNLYIL-UHFFFAOYSA-N.
| Molecular formula | C7H7ClN2O3 |
|---|---|
| Molecular weight | 202.59 g/mol |
| IUPAC name | methyl 2-chloro-6-methoxypyrimidine-4-carboxylate |
| InChIKey | OBFFZLIOVNLYIL-UHFFFAOYSA-N |
| SMILES | COC1=NC(=NC(=C1)C(=O)OC)Cl |
Computed by PubChem (NCBI)