cas: 220162-64-1 — see every product listed under this CAS number, including other names
METHYL 2-FLUORO-4-(TRIFLUOROMETHYL)BENZOATE, 95% (CAS 220162-64-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F390192-250MG |
| cas | 220162-64-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 190.58 Pln | |
| Fluorochem | 1g | 299.91 Pln | |
| Fluorochem | 5g | 794.53 Pln | |
| Fluorochem | 25g | 2590.77 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-fluoro-4-(trifluoromethyl)benzoate (CAS 220162-64-1) is a chemical compound with the molecular formula C9H6F4O2 and a molecular weight of 222.14 g/mol. IUPAC name: methyl 2-fluoro-4-(trifluoromethyl)benzoate. InChIKey: QCBVUHGECYPLFY-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O2 |
|---|---|
| Molecular weight | 222.14 g/mol |
| IUPAC name | methyl 2-fluoro-4-(trifluoromethyl)benzoate |
| InChIKey | QCBVUHGECYPLFY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C(F)(F)F)F |
Computed by PubChem (NCBI)