Methyl 2-fluoro-4-(trifluoromethyl)benzoate, 98%
cas: 220162-64-1 — see every product listed under this CAS number, including other names
Methyl 2-fluoro-4-(trifluoromethyl)benzoate, 98% (CAS 220162-64-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100mg. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A414670-250mg |
| cas | 220162-64-1 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 325.88 Pln | |
| Ambeed | 5g | 837.62 Pln | |
| Ambeed | 25g | 2745.56 Pln | |
| BLDpharm | 100mg | 219.95 Pln | |
| BLDpharm | 250mg | 253.27 Pln | |
| BLDpharm | 1g | 342.13 Pln | |
| BLDpharm | 5g | 897.49 Pln | |
| BLDpharm | 25g | 2957.87 Pln | |
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 232.40 Pln | |
| Chemat | 5g | 669.20 Pln | |
| Chemat | 25g | 2195.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Methyl 2-fluoro-4-(trifluoromethyl)benzoate (CAS 220162-64-1) is a chemical compound with the molecular formula C9H6F4O2 and a molecular weight of 222.14 g/mol. IUPAC name: methyl 2-fluoro-4-(trifluoromethyl)benzoate. InChIKey: QCBVUHGECYPLFY-UHFFFAOYSA-N.
| Molecular formula | C9H6F4O2 |
|---|---|
| Molecular weight | 222.14 g/mol |
| IUPAC name | methyl 2-fluoro-4-(trifluoromethyl)benzoate |
| InChIKey | QCBVUHGECYPLFY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1)C(F)(F)F)F |
Computed by PubChem (NCBI)
