cas: 604003-25-0 — see every product listed under this CAS number, including other names
METHYL 4,5,6,7-TETRAHYDRO-4-OXOPYRAZOLO[1,5-A]PYRAZINE-2-CARBOXYLATE, 97% (CAS 604003-25-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F390386-100MG |
| cas | 604003-25-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 685.19 Pln | |
| Fluorochem | 250mg | 825.77 Pln | |
| Fluorochem | 1g | 1861.86 Pln | |
| Fluorochem | 5g | 6375.90 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazine-2-carboxylate (CAS 604003-25-0) is a chemical compound with the molecular formula C8H9N3O3 and a molecular weight of 195.18 g/mol. IUPAC name: methyl 4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazine-2-carboxylate. InChIKey: CGSWPPZECJHSON-UHFFFAOYSA-N.
| Molecular formula | C8H9N3O3 |
|---|---|
| Molecular weight | 195.18 g/mol |
| IUPAC name | methyl 4-oxo-6,7-dihydro-5H-pyrazolo[1,5-a]pyrazine-2-carboxylate |
| InChIKey | CGSWPPZECJHSON-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NN2CCNC(=O)C2=C1 |
Computed by PubChem (NCBI)