cas: 57498-54-1 — see every product listed under this CAS number, including other names
METHYL 4-(4-METHYLPHENYL)-4-OXOBUTANOATE (CAS 57498-54-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387003-100MG |
| cas | 57498-54-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 253.05 Pln | |
| Fluorochem | 250mg | 310.33 Pln | |
| Fluorochem | 1g | 659.16 Pln | |
| Fluorochem | 5g | 2122.19 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 4-(4-methylphenyl)-4-oxobutanoate (CAS 57498-54-1) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: methyl 4-(4-methylphenyl)-4-oxobutanoate. InChIKey: GDNLLWLWRRVVEZ-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | methyl 4-(4-methylphenyl)-4-oxobutanoate |
| InChIKey | GDNLLWLWRRVVEZ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(=O)CCC(=O)OC |
Computed by PubChem (NCBI)