cas: 202146-16-5 — see every product listed under this CAS number, including other names
METHYL 4-AMINO-3-CHLORO-5-METHYLBENZOATE, 97% (CAS 202146-16-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F467152-1G |
| cas | 202146-16-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 5g | 476.93 Pln | |
| Fluorochem | 10g | 893.45 Pln | |
| Fluorochem | 25g | 2163.84 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 4-amino-3-chloro-5-methylbenzoate (CAS 202146-16-5) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: methyl 4-amino-3-chloro-5-methylbenzoate. InChIKey: SDBXHTMFAXKDML-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | methyl 4-amino-3-chloro-5-methylbenzoate |
| InChIKey | SDBXHTMFAXKDML-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1N)Cl)C(=O)OC |
Computed by PubChem (NCBI)