cas: 1211538-72-5 — see every product listed under this CAS number, including other names
METHYL 5-BROMO-3-FLUOROPYRIDINE-2-CARBOXYLATE, 98% (CAS 1211538-72-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F330702-250MG |
| cas | 1211538-72-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 159.34 Pln | |
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 5g | 768.50 Pln | |
| Fluorochem | 10g | 1486.99 Pln | |
| Fluorochem | 25g | 2533.50 Pln | |
| Fluorochem | 100g | 8140.90 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-bromo-3-fluoropyridine-2-carboxylate (CAS 1211538-72-5) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: methyl 5-bromo-3-fluoropyridine-2-carboxylate. InChIKey: UWDDDYSSTSVUJK-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | methyl 5-bromo-3-fluoropyridine-2-carboxylate |
| InChIKey | UWDDDYSSTSVUJK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=N1)Br)F |
Computed by PubChem (NCBI)