cas: 152626-88-5 — see every product listed under this CAS number, including other names
METHYL 5-NITRO-1H-INDAZOLE-6-CARBOXYLATE, 97% (CAS 152626-88-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F538003-100MG |
| cas | 152626-88-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 227.02 Pln | |
| Fluorochem | 1g | 476.93 Pln | |
| Fluorochem | 5g | 1216.26 Pln | |
| Fluorochem | 10g | 2189.87 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 5-nitro-1H-indazole-6-carboxylate (CAS 152626-88-5) is a chemical compound with the molecular formula C9H7N3O4 and a molecular weight of 221.17 g/mol. IUPAC name: methyl 5-nitro-1H-indazole-6-carboxylate. InChIKey: DEZHKDZFGIGNPH-UHFFFAOYSA-N.
| Molecular formula | C9H7N3O4 |
|---|---|
| Molecular weight | 221.17 g/mol |
| IUPAC name | methyl 5-nitro-1H-indazole-6-carboxylate |
| InChIKey | DEZHKDZFGIGNPH-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C2C=NNC2=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)