cas: 1247406-14-9 — see every product listed under this CAS number, including other names
METHYL 7-BROMOBENZOFURAN-2-CARBOXYLATE, 97% (CAS 1247406-14-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F303868-100MG |
| cas | 1247406-14-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 502.97 Pln | |
| Fluorochem | 250mg | 690.40 Pln | |
| Fluorochem | 500mg | 1060.06 Pln | |
| Fluorochem | 1g | 1346.42 Pln | |
| Fluorochem | 2.5g | 3033.32 Pln | |
| Fluorochem | 5g | 5844.83 Pln | |
| Fluorochem | 10g | 11165.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 7-bromo-1-benzofuran-2-carboxylate (CAS 1247406-14-9) is a chemical compound with the molecular formula C10H7BrO3 and a molecular weight of 255.06 g/mol. IUPAC name: methyl 7-bromo-1-benzofuran-2-carboxylate. InChIKey: BCEPJCGXVNFHHM-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO3 |
|---|---|
| Molecular weight | 255.06 g/mol |
| IUPAC name | methyl 7-bromo-1-benzofuran-2-carboxylate |
| InChIKey | BCEPJCGXVNFHHM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC2=C(O1)C(=CC=C2)Br |
Computed by PubChem (NCBI)