cas: 146725-85-1 — see every product listed under this CAS number, including other names
MEthyl (2s)-2-amino-3-(furan-2-yl)propanoate, 95%, 95% (CAS 146725-85-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HXJ6-100mg |
| cas | 146725-85-1 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 410.00 Pln | |
| Chemat | 250mg | 640.40 Pln | |
| Chemat | 1g | 1821.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl (2S)-2-amino-3-(furan-2-yl)propanoate (CAS 146725-85-1) is a chemical compound with the molecular formula C8H11NO3 and a molecular weight of 169.18 g/mol. IUPAC name: methyl (2S)-2-amino-3-(furan-2-yl)propanoate. InChIKey: RGZJZYPBZXARCU-ZETCQYMHSA-N.
| Molecular formula | C8H11NO3 |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(furan-2-yl)propanoate |
| InChIKey | RGZJZYPBZXARCU-ZETCQYMHSA-N |
| SMILES | COC(=O)[C@H](CC1=CC=CO1)N |
Computed by PubChem (NCBI)