MEthyl-(3-bromomethyl)phenoxyacetate, 90%
cas: 136645-26-6 — see every product listed under this CAS number, including other names
MEthyl-(3-bromomethyl)phenoxyacetate, 90% (CAS 136645-26-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, Chemat, Fluorochem, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A759686-100mg |
| cas | 136645-26-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 637.38 Pln | |
| Ambeed | 250mg | 915.50 Pln | |
| Ambeed | 1g | 2178.19 Pln | |
| Chemat | 100mg | 395.60 Pln | |
| Chemat | 250mg | 827.60 Pln | |
| Chemat | 1g | 2358.80 Pln | |
| Fluorochem | 100mg | 716.43 Pln | |
| BLDpharm | 100mg | 508.73 Pln | |
| BLDpharm | 250mg | 741.99 Pln | |
| BLDpharm | 1g | 1780.51 Pln | |
| Fluorochem | 250mg | 1539.06 Pln | |
| Fluorochem | 1g | 4366.19 Pln |
properties
| purity | 90% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 2-[3-(bromomethyl)phenoxy]acetate (CAS 136645-26-6) is a chemical compound with the molecular formula C10H11BrO3 and a molecular weight of 259.10 g/mol. IUPAC name: methyl 2-[3-(bromomethyl)phenoxy]acetate. InChIKey: RHYQCZSFWWWVTB-UHFFFAOYSA-N.
| Molecular formula | C10H11BrO3 |
|---|---|
| Molecular weight | 259.10 g/mol |
| IUPAC name | methyl 2-[3-(bromomethyl)phenoxy]acetate |
| InChIKey | RHYQCZSFWWWVTB-UHFFFAOYSA-N |
| SMILES | COC(=O)COC1=CC=CC(=C1)CBr |
Computed by PubChem (NCBI)