cas: 1227923-29-6 — see every product listed under this CAS number, including other names
MK-7622, 98+% (CAS 1227923-29-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A671730-100mg |
| cas | 1227923-29-6 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 4757.20 Pln | |
| AmBeed | 1mg | 343.42 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
3-[(1S,2S)-2-hydroxycyclohexyl]-6-[(6-methyl-3-pyridinyl)methyl]benzo[h]quinazolin-4-one (CAS 1227923-29-6) is a chemical compound with the molecular formula C25H25N3O2 and a molecular weight of 399.5 g/mol. IUPAC name: 3-[(1S,2S)-2-hydroxycyclohexyl]-6-[(6-methyl-3-pyridinyl)methyl]benzo[h]quinazolin-4-one. InChIKey: JUVQLZBJFOGEEO-GOTSBHOMSA-N.
| Molecular formula | C25H25N3O2 |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | 3-[(1S,2S)-2-hydroxycyclohexyl]-6-[(6-methyl-3-pyridinyl)methyl]benzo[h]quinazolin-4-one |
| InChIKey | JUVQLZBJFOGEEO-GOTSBHOMSA-N |
| SMILES | CC1=NC=C(C=C1)CC2=CC3=C(C4=CC=CC=C42)N=CN(C3=O)[C@H]5CCCC[C@@H]5O |
Computed by PubChem (NCBI)