Products 1227923-29-6
CAS 1227923-29-6 appears in our catalog under these names: M1 Receptor modulator, 95%, MK-7622, 98+%, MK-7622/ 99.83% (existing batch purity), MK–7622 (M1 receptor modulator), MK-7622. Offered by: Combi-blocks, AmBeed, TargetMol, GLPBio, Biosynth. Available pack sizes: 250mg, 1g, 100mg, 1mg, 5mg, 10mg, 25mg, 10mM (in 1ml dmso).
3-[(1S,2S)-2-hydroxycyclohexyl]-6-[(6-methyl-3-pyridinyl)methyl]benzo[h]quinazolin-4-one (CAS 1227923-29-6) is a chemical compound with the molecular formula C25H25N3O2 and a molecular weight of 399.5 g/mol. IUPAC name: 3-[(1S,2S)-2-hydroxycyclohexyl]-6-[(6-methyl-3-pyridinyl)methyl]benzo[h]quinazolin-4-one. InChIKey: JUVQLZBJFOGEEO-GOTSBHOMSA-N.
| Molecular formula | C25H25N3O2 |
|---|---|
| Molecular weight | 399.5 g/mol |
| IUPAC name | 3-[(1S,2S)-2-hydroxycyclohexyl]-6-[(6-methyl-3-pyridinyl)methyl]benzo[h]quinazolin-4-one |
| InChIKey | JUVQLZBJFOGEEO-GOTSBHOMSA-N |
| SMILES | CC1=NC=C(C=C1)CC2=CC3=C(C4=CC=CC=C42)N=CN(C3=O)[C@H]5CCCC[C@@H]5O |
Computed by PubChem (NCBI)