Products 1338934-20-5
CAS 1338934-20-5 appears in our catalog under these names: MKC9989, MKC9989/ 99.52% (existing batch purity), MKC9989 98%, MKC 9989, MKC9989, 98.33%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 50 mg.
7-hydroxy-6-methoxy-3-[2-(2-methoxyethoxy)ethyl]-4-methyl-2-oxochromene-8-carbaldehyde (CAS 1338934-20-5) is a chemical compound with the molecular formula C17H20O7 and a molecular weight of 336.3 g/mol. IUPAC name: 7-hydroxy-6-methoxy-3-[2-(2-methoxyethoxy)ethyl]-4-methyl-2-oxochromene-8-carbaldehyde. InChIKey: QSVDQIXSUDHAOF-UHFFFAOYSA-N.
| Molecular formula | C17H20O7 |
|---|---|
| Molecular weight | 336.3 g/mol |
| IUPAC name | 7-hydroxy-6-methoxy-3-[2-(2-methoxyethoxy)ethyl]-4-methyl-2-oxochromene-8-carbaldehyde |
| InChIKey | QSVDQIXSUDHAOF-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C(C(=C(C=C12)OC)O)C=O)CCOCCOC |
Computed by PubChem (NCBI)