Products 2283355-59-7
CAS 2283355-59-7 appears in our catalog under these names: MKK7–COV–9, MKK7-COV-9/ 99.55% (existing batch purity), MKK7-COV-9, 3-Acrylamido-5-(1H-indazol-3-yl)-N-methylbenzamide, MKK7-COV-9, 97.34%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 1mg, 2mg, 200mg.
3-(1H-indazol-3-yl)-N-methyl-5-(prop-2-enoylamino)benzamide (CAS 2283355-59-7) is a chemical compound with the molecular formula C18H16N4O2 and a molecular weight of 320.3 g/mol. IUPAC name: 3-(1H-indazol-3-yl)-N-methyl-5-(prop-2-enoylamino)benzamide. InChIKey: OIVBYXJDKPKZFE-UHFFFAOYSA-N.
| Molecular formula | C18H16N4O2 |
|---|---|
| Molecular weight | 320.3 g/mol |
| IUPAC name | 3-(1H-indazol-3-yl)-N-methyl-5-(prop-2-enoylamino)benzamide |
| InChIKey | OIVBYXJDKPKZFE-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=CC(=CC(=C1)C2=NNC3=CC=CC=C32)NC(=O)C=C |
Computed by PubChem (NCBI)