Products 947914-18-3
CAS 947914-18-3 appears in our catalog under these names: 2-Methoxy-N-[3-[(3-methylbenzoyl)amino]phenyl]benzamide, 98%, ML365/ 99.91% (existing batch purity), ML365, ML365 99%, ML 365, 99%, 99%. Offered by: Fluorochem, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 50mg, 100mg, 2mg, 5mg, 10mg, 25mg, 250mg, 1g.
2-methoxy-N-[3-[(3-methylbenzoyl)amino]phenyl]benzamide (CAS 947914-18-3) is a chemical compound with the molecular formula C22H20N2O3 and a molecular weight of 360.4 g/mol. IUPAC name: 2-methoxy-N-[3-[(3-methylbenzoyl)amino]phenyl]benzamide. InChIKey: UTAJHKSGYJSZBR-UHFFFAOYSA-N.
| Molecular formula | C22H20N2O3 |
|---|---|
| Molecular weight | 360.4 g/mol |
| IUPAC name | 2-methoxy-N-[3-[(3-methylbenzoyl)amino]phenyl]benzamide |
| InChIKey | UTAJHKSGYJSZBR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(=O)NC2=CC(=CC=C2)NC(=O)C3=CC=CC=C3OC |
Computed by PubChem (NCBI)