CAS 2738542-58-8 appears in our catalog under these names: MSC-4106, 98%, MSC-4106/ 100%, MSC–4106, MSC-4106, MSC-4106, 99.87%. Offered by: AmBeed, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 25 mg.
2-methyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[3,4-b]indole-7-carboxylic acid (CAS 2738542-58-8) is a chemical compound with the molecular formula C18H12F3N3O2 and a molecular weight of 359.3 g/mol. IUPAC name: 2-methyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[3,4-b]indole-7-carboxylic acid. InChIKey: HUSMWXZHQVTDRU-UHFFFAOYSA-N.
| Molecular formula | C18H12F3N3O2 |
|---|---|
| Molecular weight | 359.3 g/mol |
| IUPAC name | 2-methyl-4-[4-(trifluoromethyl)phenyl]pyrazolo[3,4-b]indole-7-carboxylic acid |
| InChIKey | HUSMWXZHQVTDRU-UHFFFAOYSA-N |
| SMILES | CN1C=C2C3=C(C=CC(=C3)C(=O)O)N(C2=N1)C4=CC=C(C=C4)C(F)(F)F |
Computed by PubChem (NCBI)