Products 2327925-35-7
CAS 2327925-35-7 appears in our catalog under these names: MT-4/ 99.54% (existing batch purity), MT-4, MT-4, 99.84%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
N-[4-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]-2-phenylacetamide (CAS 2327925-35-7) is a chemical compound with the molecular formula C21H23N5O and a molecular weight of 361.4 g/mol. IUPAC name: N-[4-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]-2-phenylacetamide. InChIKey: SKUUNAQXXGDUMF-UHFFFAOYSA-N.
| Molecular formula | C21H23N5O |
|---|---|
| Molecular weight | 361.4 g/mol |
| IUPAC name | N-[4-[[4-(dimethylamino)-6-methylpyrimidin-2-yl]amino]phenyl]-2-phenylacetamide |
| InChIKey | SKUUNAQXXGDUMF-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)NC2=CC=C(C=C2)NC(=O)CC3=CC=CC=C3)N(C)C |
Computed by PubChem (NCBI)