cas: 518044-35-4 — see every product listed under this CAS number, including other names
Mal-PEG3-Boc 97% (CAS 518044-35-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A755590-250mg |
| cas | 518044-35-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 359.25 Pln | |
| Ambeed | 1g | 909.94 Pln | |
| Ambeed | 5g | 3001.44 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A755590 |
Tert-butyl 3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoate (CAS 518044-35-4) is a chemical compound with the molecular formula C17H27NO7 and a molecular weight of 357.4 g/mol. IUPAC name: tert-butyl 3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoate. InChIKey: GBAIKTRBCFEELB-UHFFFAOYSA-N.
| Molecular formula | C17H27NO7 |
|---|---|
| Molecular weight | 357.4 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | GBAIKTRBCFEELB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCN1C(=O)C=CC1=O |
Computed by PubChem (NCBI)