cas: 1286755-26-7 — see every product listed under this CAS number, including other names
Mal-PEG5-acid, 98%, 98% (CAS 1286755-26-7) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HRU9-25mg |
| cas | 1286755-26-7 |
| size | 25mg |
| availability | 13g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 266.00 Pln | |
| Chemat | 50mg | 366.80 Pln | |
| Chemat | 100mg | 515.60 Pln | |
| Chemat | 250mg | 1086.80 Pln | |
| Chemat | 1g | 2210.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1286755-26-7) is a chemical compound with the molecular formula C17H27NO9 and a molecular weight of 389.4 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: HFYDLVZXYONWDG-UHFFFAOYSA-N.
| Molecular formula | C17H27NO9 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | HFYDLVZXYONWDG-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)