CAS 1286755-26-7 appears in our catalog under these names: Mal-peg5-acid, 95%, Mal–PEG5–acid, Mal-PEG5-acid 95%, Mal-PEG5-acid, 99.12%, Mal-PEG5-acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, MedChemExpress, Chemat. Available pack sizes: 100mg, 250mg, 1g, 25mg, 50mg, 5g, 50 mg, 100 mg.
3-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1286755-26-7) is a chemical compound with the molecular formula C17H27NO9 and a molecular weight of 389.4 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: HFYDLVZXYONWDG-UHFFFAOYSA-N.
| Molecular formula | C17H27NO9 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | HFYDLVZXYONWDG-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)