CAS 7772-85-2 is the registry number for Isopropyl 2-acetamido-3,4,6-tri-O-acetyl-2-deoxy-b-D-glucopyranoside. Offered by: Biosynth. Available pack sizes: 25g, 10g, 50g.
[(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-propan-2-yloxyoxan-2-yl]methyl acetate (CAS 7772-85-2) is a chemical compound with the molecular formula C17H27NO9 and a molecular weight of 389.4 g/mol. IUPAC name: [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-propan-2-yloxyoxan-2-yl]methyl acetate. InChIKey: KMIQMFHPUJUDMC-WRQOLXDDSA-N.
| Molecular formula | C17H27NO9 |
|---|---|
| Molecular weight | 389.4 g/mol |
| IUPAC name | [(2R,3S,4R,5R,6R)-5-acetamido-3,4-diacetyloxy-6-propan-2-yloxyoxan-2-yl]methyl acetate |
| InChIKey | KMIQMFHPUJUDMC-WRQOLXDDSA-N |
| SMILES | CC(C)O[C@H]1[C@@H]([C@H]([C@@H]([C@H](O1)COC(=O)C)OC(=O)C)OC(=O)C)NC(=O)C |
Computed by PubChem (NCBI)