cas: 123071-42-1 — see every product listed under this CAS number, including other names
Malonaldehyde bis(phenylimine) monohydrochloride, 98% (CAS 123071-42-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F552718-10G |
| cas | 123071-42-1 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 10g | 258.26 Pln | |
| Fluorochem | 25g | 466.52 Pln | |
| Fluorochem | 100g | 1565.09 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
N,N'-diphenylpropane-1,3-diimine;hydrochloride (CAS 123071-42-1) is a chemical compound with the molecular formula C15H15ClN2 and a molecular weight of 258.74 g/mol. IUPAC name: N,N'-diphenylpropane-1,3-diimine;hydrochloride. InChIKey: FLMLOZWXXPLHIE-UHFFFAOYSA-N.
| Molecular formula | C15H15ClN2 |
|---|---|
| Molecular weight | 258.74 g/mol |
| IUPAC name | N,N'-diphenylpropane-1,3-diimine;hydrochloride |
| InChIKey | FLMLOZWXXPLHIE-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N=CCC=NC2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)