cas: 1825-00-9 — see every product listed under this CAS number, including other names
Methyl β-L-arabinopyranoside, 98.00% (CAS 1825-00-9) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 2g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM30750C-10g |
| cas | 1825-00-9 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 6716.42 Pln | |
| Chemat | 1g | 1393.08 Pln | |
| Chemat | 2g | 2153.39 Pln | |
| Chemat | 5g | 4181.84 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 98.00% |
| category | Chemicals |
(2S,3R,4S,5S)-2-methoxyoxane-3,4,5-triol (CAS 1825-00-9) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (2S,3R,4S,5S)-2-methoxyoxane-3,4,5-triol. InChIKey: ZBDGHWFPLXXWRD-AZGQCCRYSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2S,3R,4S,5S)-2-methoxyoxane-3,4,5-triol |
| InChIKey | ZBDGHWFPLXXWRD-AZGQCCRYSA-N |
| SMILES | CO[C@@H]1[C@@H]([C@H]([C@H](CO1)O)O)O |
Computed by PubChem (NCBI)