cas: 1825-00-9 — see every product listed under this CAS number, including other names
Methyl beta-L-Arabinopyranoside, >95.0%(GC) (CAS 1825-00-9) is a chemical reagent available from Chemat. Available pack sizes: 200mg, 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M3832-200MG |
| cas | 1825-00-9 |
| size | 200mg |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 200mg | 231.44 Pln | |
| TCI | 1g | 457.64 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC) |
(2S,3R,4S,5S)-2-methoxyoxane-3,4,5-triol (CAS 1825-00-9) is a chemical compound with the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. IUPAC name: (2S,3R,4S,5S)-2-methoxyoxane-3,4,5-triol. InChIKey: ZBDGHWFPLXXWRD-AZGQCCRYSA-N.
| Molecular formula | C6H12O5 |
|---|---|
| Molecular weight | 164.16 g/mol |
| IUPAC name | (2S,3R,4S,5S)-2-methoxyoxane-3,4,5-triol |
| InChIKey | ZBDGHWFPLXXWRD-AZGQCCRYSA-N |
| SMILES | CO[C@@H]1[C@@H]([C@H]([C@H](CO1)O)O)O |
Computed by PubChem (NCBI)