cas: 167423-93-0 — see every product listed under this CAS number, including other names
Methyl 1-Boc-piperidine-2-carboxylate, 95% (CAS 167423-93-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F093171-5G |
| cas | 167423-93-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 91.65 Pln | |
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 25g | 122.89 Pln | |
| Fluorochem | 100g | 253.05 Pln | |
| Fluorochem | 500g | 987.17 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
1-O-tert-butyl 2-O-methyl piperidine-1,2-dicarboxylate (CAS 167423-93-0) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl piperidine-1,2-dicarboxylate. InChIKey: PVMJFJDVCVNWQN-UHFFFAOYSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl piperidine-1,2-dicarboxylate |
| InChIKey | PVMJFJDVCVNWQN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCCCC1C(=O)OC |
Computed by PubChem (NCBI)