cas: 168618-50-6 — see every product listed under this CAS number, including other names
Methyl 2'-methoxy-(1,1'-biphenyl)-3-carboxylate, 95% (CAS 168618-50-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A995940-5g |
| cas | 168618-50-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 1131.13 Pln | |
| AmBeed | 1g | 421.54 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 3-(2-methoxyphenyl)benzoate (CAS 168618-50-6) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: methyl 3-(2-methoxyphenyl)benzoate. InChIKey: NLUPAXIJLKCVFW-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | methyl 3-(2-methoxyphenyl)benzoate |
| InChIKey | NLUPAXIJLKCVFW-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC=C1C2=CC(=CC=C2)C(=O)OC |
Computed by PubChem (NCBI)