Products 79678-37-8
CAS 79678-37-8 appears in our catalog under these names: Methyl 3-(benzyloxy)benzoate, 95%, Methyl 3-(benzyloxy)benzoate 98%, Benzoic acid, 3-(phenylmethoxy)-, methyl ester, 98%, 98%, Methyl 3-(benzyloxy)benzoate, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 250mg.
Methyl 3-phenylmethoxybenzoate (CAS 79678-37-8) is a chemical compound with the molecular formula C15H14O3 and a molecular weight of 242.27 g/mol. IUPAC name: methyl 3-phenylmethoxybenzoate. InChIKey: VQEGUSMZKSIFJC-UHFFFAOYSA-N.
| Molecular formula | C15H14O3 |
|---|---|
| Molecular weight | 242.27 g/mol |
| IUPAC name | methyl 3-phenylmethoxybenzoate |
| InChIKey | VQEGUSMZKSIFJC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=CC=C1)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)