Methyl 2,3,4-trifluorobenzoate, 98%
cas: 773873-68-0 — see every product listed under this CAS number, including other names
Methyl 2,3,4-trifluorobenzoate, 98% (CAS 773873-68-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 5g, 10g, 100g, 250mg. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | CA-5948-1g |
| cas | 773873-68-0 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 1g | price on request | |
| Combi-blocks | 25g | price on request | |
| Combi-blocks | 5g | price on request | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 292.50 Pln | |
| Ambeed | 10g | 353.69 Pln | |
| Ambeed | 25g | 637.38 Pln | |
| Ambeed | 100g | 1772.12 Pln | |
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 232.40 Pln | |
| Chemat | 10g | 347.60 Pln | |
| Chemat | 25g | 491.60 Pln | |
| Chemat | 100g | 1778.00 Pln | |
| Fluorochem | 1g | 174.96 Pln | |
| Fluorochem | 5g | 242.64 Pln | |
| Fluorochem | 25g | 482.14 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 308.80 Pln | |
| BLDpharm | 10g | 375.45 Pln | |
| BLDpharm | 25g | 680.90 Pln | |
| BLDpharm | 100g | 1908.24 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
Methyl 2,3,4-trifluorobenzoate (CAS 773873-68-0) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: methyl 2,3,4-trifluorobenzoate. InChIKey: JHPAOEXOUXURFL-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2 |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | methyl 2,3,4-trifluorobenzoate |
| InChIKey | JHPAOEXOUXURFL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)F)F)F |
Computed by PubChem (NCBI)