cas: 4099-85-8 — see every product listed under this CAS number, including other names
Methyl 2,3-O-Isopropylidene-β-D-ribofuranoside, 97.74% (CAS 4099-85-8) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 10mM/1mL, 50 g, 5 g, 500 mg, 10 g, 25 g, 100 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-113949-1 g |
| cas | 4099-85-8 |
| size | 1 g |
| availability | In stock |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 287.18 Pln | |
| MedChemExpress | 10mM/1mL | 254.68 Pln | |
| MedChemExpress | 50 g | 1438.90 Pln | |
| MedChemExpress | 5 g | 407.93 Pln | |
| MedChemExpress | 500 mg | 240.74 Pln | |
| MedChemExpress | 10 g | 575.11 Pln | |
| MedChemExpress | 25 g | 960.56 Pln | |
| MedChemExpress | 100 g | 2233.02 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | 97.74% |
[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol (CAS 4099-85-8) is a chemical compound with the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. IUPAC name: [(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol. InChIKey: DXBHDBLZPXQALN-WCTZXXKLSA-N.
| Molecular formula | C9H16O5 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | [(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
| InChIKey | DXBHDBLZPXQALN-WCTZXXKLSA-N |
| SMILES | CC1(O[C@@H]2[C@H](O[C@H]([C@@H]2O1)OC)CO)C |
Computed by PubChem (NCBI)