CAS 41308-77-4 is the registry number for (2R,3S,4R,5S,6S)-2-(Allyloxy)-6-methyltetrahydro-2H-pyran-3,4,5-triol, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S,4R,5S,6R)-2-methyl-6-prop-2-enoxyoxane-3,4,5-triol (CAS 41308-77-4) is a chemical compound with the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. IUPAC name: (2S,3S,4R,5S,6R)-2-methyl-6-prop-2-enoxyoxane-3,4,5-triol. InChIKey: JPOJNSPEUPRVLQ-JTPBWFLFSA-N.
| Molecular formula | C9H16O5 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (2S,3S,4R,5S,6R)-2-methyl-6-prop-2-enoxyoxane-3,4,5-triol |
| InChIKey | JPOJNSPEUPRVLQ-JTPBWFLFSA-N |
| SMILES | C[C@H]1[C@H]([C@H]([C@@H]([C@@H](O1)OCC=C)O)O)O |
Computed by PubChem (NCBI)