Products 4594-60-9
CAS 4594-60-9 appears in our catalog under these names: Methyl 3,4-o-isopropylidene-beta-d-arabinopyranoside, 95%, Methyl 3,4-O-isopropylidene-β-D-arabinopyranoside. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 10g, 25g, 100g, 50g.
(3aR,6R,7S,7aS)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol (CAS 4594-60-9) is a chemical compound with the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. IUPAC name: (3aR,6R,7S,7aS)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol. InChIKey: KHWJEUGTHXRSES-ULAWRXDQSA-N.
| Molecular formula | C9H16O5 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | (3aR,6R,7S,7aS)-6-methoxy-2,2-dimethyl-4,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-c]pyran-7-ol |
| InChIKey | KHWJEUGTHXRSES-ULAWRXDQSA-N |
| SMILES | CC1(O[C@@H]2CO[C@H]([C@H]([C@@H]2O1)O)OC)C |
Computed by PubChem (NCBI)