cas: 29723-28-2 — see every product listed under this CAS number, including other names
Methyl 2,4,6-trimethoxybenzoate (CAS 29723-28-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch113Z99-1g |
| cas | 29723-28-2 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 347.60 Pln | |
| Chemat | 5g | 842.00 Pln | |
| Chemat | 25g | 3678.80 Pln | |
| Fluorochem | 1g | 622.72 Pln | |
| Fluorochem | 5g | 1559.89 Pln | |
| Fluorochem | 25g | 6068.71 Pln |
| delivery time | 3 weeks |
|---|
Methyl 2,4,6-trimethoxybenzoate (CAS 29723-28-2) is a chemical compound with the molecular formula C11H14O5 and a molecular weight of 226.23 g/mol. IUPAC name: methyl 2,4,6-trimethoxybenzoate. InChIKey: CEARZEQLIHOYSV-UHFFFAOYSA-N.
| Molecular formula | C11H14O5 |
|---|---|
| Molecular weight | 226.23 g/mol |
| IUPAC name | methyl 2,4,6-trimethoxybenzoate |
| InChIKey | CEARZEQLIHOYSV-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C(=O)OC)OC |
Computed by PubChem (NCBI)