cas: 2150-41-6 — see every product listed under this CAS number, including other names
Methyl 2,4-dimethoxybenzoate, 97%, 97% (CAS 2150-41-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114RLT-1g |
| cas | 2150-41-6 |
| size | 1g |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 88.40 Pln | |
| Chemat | 5g | 141.20 Pln | |
| Chemat | 25g | 453.20 Pln | |
| Chemat | 10g | 222.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2,4-dimethoxybenzoate (CAS 2150-41-6) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: methyl 2,4-dimethoxybenzoate. InChIKey: IHIJFZWLGPEYPJ-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | methyl 2,4-dimethoxybenzoate |
| InChIKey | IHIJFZWLGPEYPJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C=C1)C(=O)OC)OC |
Computed by PubChem (NCBI)