cas: 23424-36-4 — see every product listed under this CAS number, including other names
Methyl 2,4-dioxo-4-(pyridin-3-yl)butanoate, 95+% (CAS 23424-36-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A360373-1g |
| cas | 23424-36-4 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 3455.20 Pln | |
| AmBeed | 5g | 10225.60 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 2,4-dioxo-4-pyridin-3-ylbutanoate (CAS 23424-36-4) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: methyl 2,4-dioxo-4-pyridin-3-ylbutanoate. InChIKey: RDKSBIHJNITCTI-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | methyl 2,4-dioxo-4-pyridin-3-ylbutanoate |
| InChIKey | RDKSBIHJNITCTI-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=CN=CC=C1 |
Computed by PubChem (NCBI)