Methyl 2-(1,5-naphthyridin-2-yl)acetate, 97%
cas: 1092350-71-4 — see every product listed under this CAS number, including other names
Methyl 2-(1,5-naphthyridin-2-yl)acetate, 97% (CAS 1092350-71-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg, 500mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A802591-10g |
| cas | 1092350-71-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 31018.54 Pln | |
| AmBeed | 5g | 18636.52 Pln | |
| AmBeed | 1g | 6254.50 Pln | |
| Fluorochem | 100mg | 1502.61 Pln | |
| Fluorochem | 250mg | 2351.27 Pln | |
| Fluorochem | 500mg | 3881.98 Pln | |
| Fluorochem | 1g | 5777.15 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 2-(1,5-naphthyridin-2-yl)acetate (CAS 1092350-71-4) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: methyl 2-(1,5-naphthyridin-2-yl)acetate. InChIKey: QJLYPVCCYRBJQC-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | methyl 2-(1,5-naphthyridin-2-yl)acetate |
| InChIKey | QJLYPVCCYRBJQC-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=NC2=C(C=C1)N=CC=C2 |
Computed by PubChem (NCBI)