cas: 101349-30-8 — see every product listed under this CAS number, including other names
Methyl 2-(4-amino-3-chlorophenyl)acetate 95% (CAS 101349-30-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1163093-250mg |
| cas | 101349-30-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 492.75 Pln | |
| Ambeed | 1g | 1154.69 Pln | |
| Ambeed | 5g | 3746.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1163093 |
Methyl 2-(4-amino-3-chlorophenyl)acetate (CAS 101349-30-8) is a chemical compound with the molecular formula C9H10ClNO2 and a molecular weight of 199.63 g/mol. IUPAC name: methyl 2-(4-amino-3-chlorophenyl)acetate. InChIKey: FDEHBKRHLQPVSL-UHFFFAOYSA-N.
| Molecular formula | C9H10ClNO2 |
|---|---|
| Molecular weight | 199.63 g/mol |
| IUPAC name | methyl 2-(4-amino-3-chlorophenyl)acetate |
| InChIKey | FDEHBKRHLQPVSL-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC(=C(C=C1)N)Cl |
Computed by PubChem (NCBI)